C23H28N2O4 — CID 175707913
tert-butyl (3S)-3-[[(2S)-2-amino-3-phenylpropanoyl]amino]-2-oxo-4-phenylbutanoate (PubChem CID 175707913) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[(2S)-2-amino-3-phenylpropanoyl]amino]-2-oxo-4-phenylbutanoate.
| Compound Name | tert-butyl (3S)-3-[[(2S)-2-amino-3-phenylpropanoyl]amino]-2-oxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 175707913 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | tert-butyl (3S)-3-[[(2S)-2-amino-3-phenylpropanoyl]amino]-2-oxo-4-phenylbutanoate |
| SMILES | CC(C)(C)OC(=O)C(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C23H28N2O4/c1-23(2,3)29-22(28)20(26)19(15-17-12-8-5-9-13-17)25-21(27)18(24)14-16-10-6-4-7-11-16/h4-13,18-19H,14-15,24H2,1-3H3,(H,25,27)/t18-,19-/m0/s1 |
| InChIKey | HJNWUXPKZTWIDS-OALUTQOASA-N |
| XLogP | 2.19 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|