C30H43N4O8P — CID 172764969
bis[1-[[(2S)-2-amino-3-phenylpropanoyl]amino]-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phosphinic acid (PubChem CID 172764969) has the molecular formula C30H43N4O8P and a molecular weight of 618.67 g/mol. Its IUPAC name is bis[1-[[(2S)-2-amino-3-phenylpropanoyl]amino]-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phosphinic acid.
| Compound Name | bis[1-[[(2S)-2-amino-3-phenylpropanoyl]amino]-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phosphinic acid |
|---|---|
| PubChem CID | 172764969 |
| Molecular Formula | C30H43N4O8P |
| Molecular Weight | 618.67 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | bis[1-[[(2S)-2-amino-3-phenylpropanoyl]amino]-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phosphinic acid |
| SMILES | CC(C)(C)OC(=O)C(NC(=O)[C@@H](N)Cc1ccccc1)P(=O)(O)C(NC(=O)[C@@H](N)Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H43N4O8P/c1-29(2,3)41-27(37)25(33-23(35)21(31)17-19-13-9-7-10-14-19)43(39,40)26(28(38)42-30(4,5)6)34-24(36)22(32)18-20-15-11-8-12-16-20/h7-16,21-22,25-26H,17-18,31-32H2,1-6H3,(H,33,35)(H,34,36)(H,39,40)/t21-,22-,25?,26?/m0/s1 |
| InChIKey | MEPKVGOVBNXBCO-FPMFRTRJSA-N |
| XLogP | 1.96 |
| TPSA | 200.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.67 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|