C20H26N2O2 — CID 57170607
tert-butyl 2-amino-3-[4-(benzylamino)phenyl]propanoate (PubChem CID 57170607) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is tert-butyl 2-amino-3-[4-(benzylamino)phenyl]propanoate.
| Compound Name | tert-butyl 2-amino-3-[4-(benzylamino)phenyl]propanoate |
|---|---|
| PubChem CID | 57170607 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | tert-butyl 2-amino-3-[4-(benzylamino)phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)C(N)Cc1ccc(NCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N2O2/c1-20(2,3)24-19(23)18(21)13-15-9-11-17(12-10-15)22-14-16-7-5-4-6-8-16/h4-12,18,22H,13-14,21H2,1-3H3 |
| InChIKey | NKEMDHVGPQQSRD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |