C11H16NO6P — CID 56978908
[1-[(2S)-2-amino-3-phenylpropanoyl]oxy-1-hydroxyethyl]phosphonic acid (PubChem CID 56978908) has the molecular formula C11H16NO6P and a molecular weight of 289.22 g/mol. Its IUPAC name is [1-[(2S)-2-amino-3-phenylpropanoyl]oxy-1-hydroxyethyl]phosphonic acid.
| Compound Name | [1-[(2S)-2-amino-3-phenylpropanoyl]oxy-1-hydroxyethyl]phosphonic acid |
|---|---|
| PubChem CID | 56978908 |
| Molecular Formula | C11H16NO6P |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | [1-[(2S)-2-amino-3-phenylpropanoyl]oxy-1-hydroxyethyl]phosphonic acid |
| SMILES | CC(O)(OC(=O)[C@@H](N)Cc1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C11H16NO6P/c1-11(14,19(15,16)17)18-10(13)9(12)7-8-5-3-2-4-6-8/h2-6,9,14H,7,12H2,1H3,(H2,15,16,17)/t9-,11?/m0/s1 |
| InChIKey | STRXKFKVODLHTM-FTNKSUMCSA-N |
| XLogP | -0.06 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|