C10H14N2O2 — CID 19891176
benzyl 2,3-diaminopropanoate (PubChem CID 19891176) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is benzyl 2,3-diaminopropanoate.
| Compound Name | benzyl 2,3-diaminopropanoate |
|---|---|
| PubChem CID | 19891176 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | benzyl 2,3-diaminopropanoate |
| SMILES | NCC(N)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C10H14N2O2/c11-6-9(12)10(13)14-7-8-4-2-1-3-5-8/h1-5,9H,6-7,11-12H2 |
| InChIKey | GEQXYRVJQQMTCY-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |