About benzyl 2-amino-4-bromobutanoate
benzyl 2-amino-4-bromobutanoate (PubChem CID 18467389) has the molecular formula C11H14BrNO2
and a molecular weight of 272.14 g/mol. Its IUPAC name is benzyl 2-amino-4-bromobutanoate.
Molecular Properties
| Compound Name | benzyl 2-amino-4-bromobutanoate |
| PubChem CID | 18467389 |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | benzyl 2-amino-4-bromobutanoate |
| SMILES | NC(CCBr)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C11H14BrNO2/c12-7-6-10(13)11(14)15-8-9-4-2-1-3-5-9/h1-5,10H,6-8,13H2 |
| InChIKey | QECREAOBRVDNKW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-amino-4-bromobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-amino-4-bromobutanoate?
The IUPAC name of benzyl 2-amino-4-bromobutanoate (CID 18467389) is benzyl 2-amino-4-bromobutanoate.
What is the SMILES notation for benzyl 2-amino-4-bromobutanoate?
The canonical SMILES for benzyl 2-amino-4-bromobutanoate is NC(CCBr)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-amino-4-bromobutanoate?
The InChIKey is QECREAOBRVDNKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrNO2/c12-7-6-10(13)11(14)15-8-9-4-2-1-3-5-9/h1-5,10H,6-8,13H2.
What are the key properties of benzyl 2-amino-4-bromobutanoate?
benzyl 2-amino-4-bromobutanoate has a molecular weight of 272.14 g/mol, XLogP of 1.84, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-amino-4-bromobutanoate is sourced from PubChem (CID 18467389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).