C27H32N2O6 — CID 157386545
(2S)-2-amino-3-hydroxypropanoic acid;benzyl (2S)-2-(dibenzylamino)-3-hydroxypropanoate (PubChem CID 157386545) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxypropanoic acid;benzyl (2S)-2-(dibenzylamino)-3-hydroxypropanoate.
| Compound Name | (2S)-2-amino-3-hydroxypropanoic acid;benzyl (2S)-2-(dibenzylamino)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 157386545 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | (2S)-2-amino-3-hydroxypropanoic acid;benzyl (2S)-2-(dibenzylamino)-3-hydroxypropanoate |
| SMILES | N[C@@H](CO)C(=O)O.O=C(OCc1ccccc1)[C@H](CO)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H25NO3.C3H7NO3/c26-18-23(24(27)28-19-22-14-8-3-9-15-22)25(16-20-10-4-1-5-11-20)17-21-12-6-2-7-13-21;4-2(1-5)3(6)7/h1-15,23,26H,16-19H2;2,5H,1,4H2,(H,6,7)/t23-;2-/m00/s1 |
| InChIKey | BLMRRPHIUPETSO-ODAZUNGQSA-N |
| XLogP | 2.18 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |