C32H38N2O7 — CID 164987859
(2R)-2-aminopentanedioic acid;benzyl (4R)-4-(dibenzylamino)-5-oxohexanoate (PubChem CID 164987859) has the molecular formula C32H38N2O7 and a molecular weight of 562.66 g/mol. Its IUPAC name is (2R)-2-aminopentanedioic acid;benzyl (4R)-4-(dibenzylamino)-5-oxohexanoate.
| Compound Name | (2R)-2-aminopentanedioic acid;benzyl (4R)-4-(dibenzylamino)-5-oxohexanoate |
|---|---|
| PubChem CID | 164987859 |
| Molecular Formula | C32H38N2O7 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | (2R)-2-aminopentanedioic acid;benzyl (4R)-4-(dibenzylamino)-5-oxohexanoate |
| SMILES | CC(=O)[C@@H](CCC(=O)OCc1ccccc1)N(Cc1ccccc1)Cc1ccccc1.N[C@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C27H29NO3.C5H9NO4/c1-22(29)26(17-18-27(30)31-21-25-15-9-4-10-16-25)28(19-23-11-5-2-6-12-23)20-24-13-7-3-8-14-24;6-3(5(9)10)1-2-4(7)8/h2-16,26H,17-21H2,1H3;3H,1-2,6H2,(H,7,8)(H,9,10)/t26-;3-/m11/s1 |
| InChIKey | GKMZXBDKQBOVLD-CEOBKQDMSA-N |
| XLogP | 4.43 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |