benzyl carbamate;2-phenylsulfanylpropanoic acid

C17H19NO4S — CID 18690490

IUPACbenzyl carbamate;2-phenylsulfanylpropanoic acid
SMILESCC(Sc1ccccc1)C(=O)O.NC(=O)OCc1ccccc1
InChIInChI=1S/C9H10O2S.C8H9NO2/c1-7(9(10)11)12-8-5-3-2-4-6-8;9-8(10)11-6-7-4-2-1-3-5-7/h2-7H,1H3,(H,10,11);1-5H,6H2,(H2,9,10)
InChIKeyXMVWZQORYQZZAL-UHFFFAOYSA-N
MW333.41 g/mol
LogP3.53
Rot. Bonds5

About benzyl carbamate;2-phenylsulfanylpropanoic acid

benzyl carbamate;2-phenylsulfanylpropanoic acid (PubChem CID 18690490) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is benzyl carbamate;2-phenylsulfanylpropanoic acid.

Molecular Properties

Compound Namebenzyl carbamate;2-phenylsulfanylpropanoic acid
PubChem CID18690490
Molecular FormulaC17H19NO4S
Molecular Weight333.41 g/mol
Exact Mass333.10
IUPAC Namebenzyl carbamate;2-phenylsulfanylpropanoic acid
SMILESCC(Sc1ccccc1)C(=O)O.NC(=O)OCc1ccccc1
InChIInChI=1S/C9H10O2S.C8H9NO2/c1-7(9(10)11)12-8-5-3-2-4-6-8;9-8(10)11-6-7-4-2-1-3-5-7/h2-7H,1H3,(H,10,11);1-5H,6H2,(H2,9,10)
InChIKeyXMVWZQORYQZZAL-UHFFFAOYSA-N
XLogP3.53
TPSA89.62 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.41
LogP ≤ 53.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze benzyl carbamate;2-phenylsulfanylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl carbamate;2-phenylsulfanylpropanoic acid?
The IUPAC name of benzyl carbamate;2-phenylsulfanylpropanoic acid (CID 18690490) is benzyl carbamate;2-phenylsulfanylpropanoic acid.
What is the SMILES notation for benzyl carbamate;2-phenylsulfanylpropanoic acid?
The canonical SMILES for benzyl carbamate;2-phenylsulfanylpropanoic acid is CC(Sc1ccccc1)C(=O)O.NC(=O)OCc1ccccc1.
What is the InChIKey of benzyl carbamate;2-phenylsulfanylpropanoic acid?
The InChIKey is XMVWZQORYQZZAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S.C8H9NO2/c1-7(9(10)11)12-8-5-3-2-4-6-8;9-8(10)11-6-7-4-2-1-3-5-7/h2-7H,1H3,(H,10,11);1-5H,6H2,(H2,9,10).
What are the key properties of benzyl carbamate;2-phenylsulfanylpropanoic acid?
benzyl carbamate;2-phenylsulfanylpropanoic acid has a molecular weight of 333.41 g/mol, XLogP of 3.53, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl carbamate;2-phenylsulfanylpropanoic acid is sourced from PubChem (CID 18690490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).