C18H19NO4S — CID 91872589
(2S,3R)-2-(phenylmethoxycarbonylamino)-3-phenylsulfanylbutanoic acid (PubChem CID 91872589) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is (2S,3R)-2-(phenylmethoxycarbonylamino)-3-phenylsulfanylbutanoic acid.
| Compound Name | (2S,3R)-2-(phenylmethoxycarbonylamino)-3-phenylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 91872589 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (2S,3R)-2-(phenylmethoxycarbonylamino)-3-phenylsulfanylbutanoic acid |
| SMILES | C[C@@H](Sc1ccccc1)[C@@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H19NO4S/c1-13(24-15-10-6-3-7-11-15)16(17(20)21)19-18(22)23-12-14-8-4-2-5-9-14/h2-11,13,16H,12H2,1H3,(H,19,22)(H,20,21)/t13-,16-/m1/s1 |
| InChIKey | NJRXLQNMKCMJEI-CZUORRHYSA-N |
| XLogP | 3.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |