About benzyl but-3-enoate
benzyl but-3-enoate (PubChem CID 11019385) has the molecular formula C11H12O2
and a molecular weight of 176.21 g/mol. Its IUPAC name is benzyl but-3-enoate.
Molecular Properties
| Compound Name | benzyl but-3-enoate |
| PubChem CID | 11019385 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | benzyl but-3-enoate |
| SMILES | C=CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C11H12O2/c1-2-6-11(12)13-9-10-7-4-3-5-8-10/h2-5,7-8H,1,6,9H2 |
| InChIKey | DIHWNRNXRGICRQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzyl but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl but-3-enoate?
The IUPAC name of benzyl but-3-enoate (CID 11019385) is benzyl but-3-enoate.
What is the SMILES notation for benzyl but-3-enoate?
The canonical SMILES for benzyl but-3-enoate is C=CCC(=O)OCc1ccccc1.
What is the InChIKey of benzyl but-3-enoate?
The InChIKey is DIHWNRNXRGICRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c1-2-6-11(12)13-9-10-7-4-3-5-8-10/h2-5,7-8H,1,6,9H2.
What are the key properties of benzyl but-3-enoate?
benzyl but-3-enoate has a molecular weight of 176.21 g/mol, XLogP of 2.31, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl but-3-enoate is sourced from PubChem (CID 11019385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).