C11H16O5 — CID 69033542
(2R,3S)-1-phenylmethoxybutane-1,2,3,4-tetrol (PubChem CID 69033542) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (2R,3S)-1-phenylmethoxybutane-1,2,3,4-tetrol.
| Compound Name | (2R,3S)-1-phenylmethoxybutane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 69033542 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (2R,3S)-1-phenylmethoxybutane-1,2,3,4-tetrol |
| SMILES | OC[C@H](O)[C@@H](O)C(O)OCc1ccccc1 |
| InChI | InChI=1S/C11H16O5/c12-6-9(13)10(14)11(15)16-7-8-4-2-1-3-5-8/h1-5,9-15H,6-7H2/t9-,10+,11?/m0/s1 |
| InChIKey | BSWPLMLOALXCLA-MTULOOOASA-N |
| XLogP | -0.76 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|