C10H13FO4 — CID 71187743
2-fluoro-3-phenylmethoxypropane-1,1,3-triol (PubChem CID 71187743) has the molecular formula C10H13FO4 and a molecular weight of 216.21 g/mol. Its IUPAC name is 2-fluoro-3-phenylmethoxypropane-1,1,3-triol.
| Compound Name | 2-fluoro-3-phenylmethoxypropane-1,1,3-triol |
|---|---|
| PubChem CID | 71187743 |
| Molecular Formula | C10H13FO4 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 2-fluoro-3-phenylmethoxypropane-1,1,3-triol |
| SMILES | OC(O)C(F)C(O)OCc1ccccc1 |
| InChI | InChI=1S/C10H13FO4/c11-8(9(12)13)10(14)15-6-7-4-2-1-3-5-7/h1-5,8-10,12-14H,6H2 |
| InChIKey | WIOWWUVFXXVZEB-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|