C20H23F3O3 — CID 15965591
(2R,3R,4R,5R)-2,4,5-trifluoro-1,6-bis(phenylmethoxy)hexan-3-ol (PubChem CID 15965591) has the molecular formula C20H23F3O3 and a molecular weight of 368.39 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2,4,5-trifluoro-1,6-bis(phenylmethoxy)hexan-3-ol.
| Compound Name | (2R,3R,4R,5R)-2,4,5-trifluoro-1,6-bis(phenylmethoxy)hexan-3-ol |
|---|---|
| PubChem CID | 15965591 |
| Molecular Formula | C20H23F3O3 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (2R,3R,4R,5R)-2,4,5-trifluoro-1,6-bis(phenylmethoxy)hexan-3-ol |
| SMILES | O[C@@H]([C@@H](F)[C@H](F)COCc1ccccc1)[C@H](F)COCc1ccccc1 |
| InChI | InChI=1S/C20H23F3O3/c21-17(13-25-11-15-7-3-1-4-8-15)19(23)20(24)18(22)14-26-12-16-9-5-2-6-10-16/h1-10,17-20,24H,11-14H2/t17-,18-,19+,20-/m1/s1 |
| InChIKey | CMYZKALXRUPHFG-YSTOQKLRSA-N |
| XLogP | 3.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |