About fluorobenzene;2-methyl-4-phenylmethoxypentan-3-ol
fluorobenzene;2-methyl-4-phenylmethoxypentan-3-ol (PubChem CID 142400351) has the molecular formula C19H25FO2
and a molecular weight of 304.40 g/mol. Its IUPAC name is fluorobenzene;2-methyl-4-phenylmethoxypentan-3-ol.
Molecular Properties
| Compound Name | fluorobenzene;2-methyl-4-phenylmethoxypentan-3-ol |
| PubChem CID | 142400351 |
| Molecular Formula | C19H25FO2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | fluorobenzene;2-methyl-4-phenylmethoxypentan-3-ol |
| SMILES | CC(C)C(O)C(C)OCc1ccccc1.Fc1ccccc1 |
| InChI | InChI=1S/C13H20O2.C6H5F/c1-10(2)13(14)11(3)15-9-12-7-5-4-6-8-12;7-6-4-2-1-3-5-6/h4-8,10-11,13-14H,9H2,1-3H3;1-5H |
| InChIKey | RBFAUHJPDUNEQH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze fluorobenzene;2-methyl-4-phenylmethoxypentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluorobenzene;2-methyl-4-phenylmethoxypentan-3-ol?
The IUPAC name of fluorobenzene;2-methyl-4-phenylmethoxypentan-3-ol (CID 142400351) is fluorobenzene;2-methyl-4-phenylmethoxypentan-3-ol.
What is the SMILES notation for fluorobenzene;2-methyl-4-phenylmethoxypentan-3-ol?
The canonical SMILES for fluorobenzene;2-methyl-4-phenylmethoxypentan-3-ol is CC(C)C(O)C(C)OCc1ccccc1.Fc1ccccc1.
What is the InChIKey of fluorobenzene;2-methyl-4-phenylmethoxypentan-3-ol?
The InChIKey is RBFAUHJPDUNEQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2.C6H5F/c1-10(2)13(14)11(3)15-9-12-7-5-4-6-8-12;7-6-4-2-1-3-5-6/h4-8,10-11,13-14H,9H2,1-3H3;1-5H.
What are the key properties of fluorobenzene;2-methyl-4-phenylmethoxypentan-3-ol?
fluorobenzene;2-methyl-4-phenylmethoxypentan-3-ol has a molecular weight of 304.40 g/mol, XLogP of 4.43, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluorobenzene;2-methyl-4-phenylmethoxypentan-3-ol is sourced from PubChem (CID 142400351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).