C17H26O3S — CID 13460109
S-tert-butyl (2S,3S,4S)-3-hydroxy-2-methyl-4-phenylmethoxypentanethioate (PubChem CID 13460109) has the molecular formula C17H26O3S and a molecular weight of 310.46 g/mol. Its IUPAC name is S-tert-butyl (2S,3S,4S)-3-hydroxy-2-methyl-4-phenylmethoxypentanethioate.
| Compound Name | S-tert-butyl (2S,3S,4S)-3-hydroxy-2-methyl-4-phenylmethoxypentanethioate |
|---|---|
| PubChem CID | 13460109 |
| Molecular Formula | C17H26O3S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | S-tert-butyl (2S,3S,4S)-3-hydroxy-2-methyl-4-phenylmethoxypentanethioate |
| SMILES | C[C@H](OCc1ccccc1)[C@@H](O)[C@H](C)C(=O)SC(C)(C)C |
| InChI | InChI=1S/C17H26O3S/c1-12(16(19)21-17(3,4)5)15(18)13(2)20-11-14-9-7-6-8-10-14/h6-10,12-13,15,18H,11H2,1-5H3/t12-,13-,15-/m0/s1 |
| InChIKey | SABIWQMSAZDCMJ-YDHLFZDLSA-N |
| XLogP | 3.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|