C20H32O3SSi — CID 102065423
S-tert-butyl (3R,4S)-3-(1-methylsiletan-1-yl)oxy-4-phenylmethoxypentanethioate (PubChem CID 102065423) has the molecular formula C20H32O3SSi and a molecular weight of 380.63 g/mol. Its IUPAC name is S-tert-butyl (3R,4S)-3-(1-methylsiletan-1-yl)oxy-4-phenylmethoxypentanethioate.
| Compound Name | S-tert-butyl (3R,4S)-3-(1-methylsiletan-1-yl)oxy-4-phenylmethoxypentanethioate |
|---|---|
| PubChem CID | 102065423 |
| Molecular Formula | C20H32O3SSi |
| Molecular Weight | 380.63 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | S-tert-butyl (3R,4S)-3-(1-methylsiletan-1-yl)oxy-4-phenylmethoxypentanethioate |
| SMILES | C[C@H](OCc1ccccc1)[C@@H](CC(=O)SC(C)(C)C)O[Si]1(C)CCC1 |
| InChI | InChI=1S/C20H32O3SSi/c1-16(22-15-17-10-7-6-8-11-17)18(23-25(5)12-9-13-25)14-19(21)24-20(2,3)4/h6-8,10-11,16,18H,9,12-15H2,1-5H3/t16-,18+/m0/s1 |
| InChIKey | RCLYKBYPJJVVSN-FUHWJXTLSA-N |
| XLogP | 5.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.63 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|