C32H38O5S — CID 10792419
S-tert-butyl (3S,4S,5R)-3,6-dihydroxy-3-[(Z)-2-phenylethenyl]-4,5-bis(phenylmethoxy)hexanethioate (PubChem CID 10792419) has the molecular formula C32H38O5S and a molecular weight of 534.72 g/mol. Its IUPAC name is S-tert-butyl (3S,4S,5R)-3,6-dihydroxy-3-[(Z)-2-phenylethenyl]-4,5-bis(phenylmethoxy)hexanethioate.
| Compound Name | S-tert-butyl (3S,4S,5R)-3,6-dihydroxy-3-[(Z)-2-phenylethenyl]-4,5-bis(phenylmethoxy)hexanethioate |
|---|---|
| PubChem CID | 10792419 |
| Molecular Formula | C32H38O5S |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | S-tert-butyl (3S,4S,5R)-3,6-dihydroxy-3-[(Z)-2-phenylethenyl]-4,5-bis(phenylmethoxy)hexanethioate |
| SMILES | CC(C)(C)SC(=O)C[C@](O)(/C=C\c1ccccc1)[C@@H](OCc1ccccc1)[C@@H](CO)OCc1ccccc1 |
| InChI | InChI=1S/C32H38O5S/c1-31(2,3)38-29(34)21-32(35,20-19-25-13-7-4-8-14-25)30(37-24-27-17-11-6-12-18-27)28(22-33)36-23-26-15-9-5-10-16-26/h4-20,28,30,33,35H,21-24H2,1-3H3/b20-19-/t28-,30+,32-/m1/s1 |
| InChIKey | YLBVOINWSDSQMC-LLCLVEMXSA-N |
| XLogP | 6.04 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|