C19H28O4 — CID 11088505
methyl (E,5S,6S,7S)-4-ethyl-6-hydroxy-5-methyl-7-phenylmethoxyoct-3-enoate (PubChem CID 11088505) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is methyl (E,5S,6S,7S)-4-ethyl-6-hydroxy-5-methyl-7-phenylmethoxyoct-3-enoate.
| Compound Name | methyl (E,5S,6S,7S)-4-ethyl-6-hydroxy-5-methyl-7-phenylmethoxyoct-3-enoate |
|---|---|
| PubChem CID | 11088505 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | methyl (E,5S,6S,7S)-4-ethyl-6-hydroxy-5-methyl-7-phenylmethoxyoct-3-enoate |
| SMILES | CC/C(=C\CC(=O)OC)[C@H](C)[C@H](O)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C19H28O4/c1-5-17(11-12-18(20)22-4)14(2)19(21)15(3)23-13-16-9-7-6-8-10-16/h6-11,14-15,19,21H,5,12-13H2,1-4H3/b17-11+/t14-,15-,19-/m0/s1 |
| InChIKey | ULFHDVXDEGWPSA-LDORLHNNSA-N |
| XLogP | 3.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|