C19H27NO5 — CID 177424086
methyl (Z,5S,6R)-6-(methoxycarbonylamino)-4,5-dimethyl-7-phenylmethoxyhept-3-enoate (PubChem CID 177424086) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl (Z,5S,6R)-6-(methoxycarbonylamino)-4,5-dimethyl-7-phenylmethoxyhept-3-enoate.
| Compound Name | methyl (Z,5S,6R)-6-(methoxycarbonylamino)-4,5-dimethyl-7-phenylmethoxyhept-3-enoate |
|---|---|
| PubChem CID | 177424086 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | methyl (Z,5S,6R)-6-(methoxycarbonylamino)-4,5-dimethyl-7-phenylmethoxyhept-3-enoate |
| SMILES | COC(=O)C/C=C(/C)[C@H](C)[C@H](COCc1ccccc1)NC(=O)OC |
| InChI | InChI=1S/C19H27NO5/c1-14(10-11-18(21)23-3)15(2)17(20-19(22)24-4)13-25-12-16-8-6-5-7-9-16/h5-10,15,17H,11-13H2,1-4H3,(H,20,22)/b14-10-/t15-,17-/m0/s1 |
| InChIKey | GATHPJQQPKJUIF-HRQLYBHBSA-N |
| XLogP | 3.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|