C23H28N2O5 — CID 24749996
methyl (Z)-3-(benzylamino)-2-[(1R)-1-(methoxycarbonylamino)-2-phenylmethoxyethyl]but-2-enoate (PubChem CID 24749996) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is methyl (Z)-3-(benzylamino)-2-[(1R)-1-(methoxycarbonylamino)-2-phenylmethoxyethyl]but-2-enoate.
| Compound Name | methyl (Z)-3-(benzylamino)-2-[(1R)-1-(methoxycarbonylamino)-2-phenylmethoxyethyl]but-2-enoate |
|---|---|
| PubChem CID | 24749996 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | methyl (Z)-3-(benzylamino)-2-[(1R)-1-(methoxycarbonylamino)-2-phenylmethoxyethyl]but-2-enoate |
| SMILES | COC(=O)N[C@@H](COCc1ccccc1)/C(C(=O)OC)=C(\C)NCc1ccccc1 |
| InChI | InChI=1S/C23H28N2O5/c1-17(24-14-18-10-6-4-7-11-18)21(22(26)28-2)20(25-23(27)29-3)16-30-15-19-12-8-5-9-13-19/h4-13,20,24H,14-16H2,1-3H3,(H,25,27)/b21-17-/t20-/m0/s1 |
| InChIKey | MVANLGIDPNXDQN-HOJYTFPLSA-N |
| XLogP | 3.16 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|