C22H26N2O5 — CID 24750118
methyl (Z)-3-(benzylamino)-2-[(S)-(methoxycarbonylamino)-(3-methoxyphenyl)methyl]but-2-enoate (PubChem CID 24750118) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is methyl (Z)-3-(benzylamino)-2-[(S)-(methoxycarbonylamino)-(3-methoxyphenyl)methyl]but-2-enoate.
| Compound Name | methyl (Z)-3-(benzylamino)-2-[(S)-(methoxycarbonylamino)-(3-methoxyphenyl)methyl]but-2-enoate |
|---|---|
| PubChem CID | 24750118 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | methyl (Z)-3-(benzylamino)-2-[(S)-(methoxycarbonylamino)-(3-methoxyphenyl)methyl]but-2-enoate |
| SMILES | COC(=O)N[C@H](/C(C(=O)OC)=C(\C)NCc1ccccc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C22H26N2O5/c1-15(23-14-16-9-6-5-7-10-16)19(21(25)28-3)20(24-22(26)29-4)17-11-8-12-18(13-17)27-2/h5-13,20,23H,14H2,1-4H3,(H,24,26)/b19-15-/t20-/m0/s1 |
| InChIKey | FNNWYZAENJFRJX-YKRMCXMESA-N |
| XLogP | 3.33 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|