C21H30N2O4 — CID 24749994
methyl (Z)-3-(benzylamino)-2-[(S)-cyclohexyl-(methoxycarbonylamino)methyl]but-2-enoate (PubChem CID 24749994) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is methyl (Z)-3-(benzylamino)-2-[(S)-cyclohexyl-(methoxycarbonylamino)methyl]but-2-enoate.
| Compound Name | methyl (Z)-3-(benzylamino)-2-[(S)-cyclohexyl-(methoxycarbonylamino)methyl]but-2-enoate |
|---|---|
| PubChem CID | 24749994 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | methyl (Z)-3-(benzylamino)-2-[(S)-cyclohexyl-(methoxycarbonylamino)methyl]but-2-enoate |
| SMILES | COC(=O)N[C@H](/C(C(=O)OC)=C(\C)NCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C21H30N2O4/c1-15(22-14-16-10-6-4-7-11-16)18(20(24)26-2)19(23-21(25)27-3)17-12-8-5-9-13-17/h4,6-7,10-11,17,19,22H,5,8-9,12-14H2,1-3H3,(H,23,25)/b18-15-/t19-/m0/s1 |
| InChIKey | DOZGOUOQYIAHED-VZWFDDOASA-N |
| XLogP | 3.53 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|