C17H24O4 — CID 15701071
methyl (E,5S,6R)-6-methoxy-5-methyl-7-phenylmethoxyhept-3-enoate (PubChem CID 15701071) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl (E,5S,6R)-6-methoxy-5-methyl-7-phenylmethoxyhept-3-enoate.
| Compound Name | methyl (E,5S,6R)-6-methoxy-5-methyl-7-phenylmethoxyhept-3-enoate |
|---|---|
| PubChem CID | 15701071 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | methyl (E,5S,6R)-6-methoxy-5-methyl-7-phenylmethoxyhept-3-enoate |
| SMILES | COC(=O)C/C=C/[C@H](C)[C@H](COCc1ccccc1)OC |
| InChI | InChI=1S/C17H24O4/c1-14(8-7-11-17(18)20-3)16(19-2)13-21-12-15-9-5-4-6-10-15/h4-10,14,16H,11-13H2,1-3H3/b8-7+/t14-,16-/m0/s1 |
| InChIKey | JUEIILUQEWVURH-MNJDHSKXSA-N |
| XLogP | 2.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|