C14H22O2 — CID 10799076
(3R,4S,5S)-4-methyl-5-phenylmethoxyhexan-3-ol (PubChem CID 10799076) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (3R,4S,5S)-4-methyl-5-phenylmethoxyhexan-3-ol.
| Compound Name | (3R,4S,5S)-4-methyl-5-phenylmethoxyhexan-3-ol |
|---|---|
| PubChem CID | 10799076 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (3R,4S,5S)-4-methyl-5-phenylmethoxyhexan-3-ol |
| SMILES | CC[C@@H](O)[C@H](C)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C14H22O2/c1-4-14(15)11(2)12(3)16-10-13-8-6-5-7-9-13/h5-9,11-12,14-15H,4,10H2,1-3H3/t11-,12+,14-/m1/s1 |
| InChIKey | IKIUTUKLZAJVDU-MBNYWOFBSA-N |
| XLogP | 3.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |