C17H24O2 — CID 71605266
(3R,4S,5R,6S)-4,6-dimethyl-5-phenylmethoxyoct-7-yn-3-ol (PubChem CID 71605266) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (3R,4S,5R,6S)-4,6-dimethyl-5-phenylmethoxyoct-7-yn-3-ol.
| Compound Name | (3R,4S,5R,6S)-4,6-dimethyl-5-phenylmethoxyoct-7-yn-3-ol |
|---|---|
| PubChem CID | 71605266 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (3R,4S,5R,6S)-4,6-dimethyl-5-phenylmethoxyoct-7-yn-3-ol |
| SMILES | C#C[C@H](C)[C@@H](OCc1ccccc1)[C@@H](C)[C@H](O)CC |
| InChI | InChI=1S/C17H24O2/c1-5-13(3)17(14(4)16(18)6-2)19-12-15-10-8-7-9-11-15/h1,7-11,13-14,16-18H,6,12H2,2-4H3/t13-,14-,16+,17+/m0/s1 |
| InChIKey | LRIGQOHWKLIULD-XJNFMUPTSA-N |
| XLogP | 3.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|