C16H22O4 — CID 102482255
(3R,4R)-4-(methoxymethoxy)-3-phenylmethoxyhept-6-yn-2-ol (PubChem CID 102482255) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (3R,4R)-4-(methoxymethoxy)-3-phenylmethoxyhept-6-yn-2-ol.
| Compound Name | (3R,4R)-4-(methoxymethoxy)-3-phenylmethoxyhept-6-yn-2-ol |
|---|---|
| PubChem CID | 102482255 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (3R,4R)-4-(methoxymethoxy)-3-phenylmethoxyhept-6-yn-2-ol |
| SMILES | C#CC[C@@H](OCOC)[C@H](OCc1ccccc1)C(C)O |
| InChI | InChI=1S/C16H22O4/c1-4-8-15(20-12-18-3)16(13(2)17)19-11-14-9-6-5-7-10-14/h1,5-7,9-10,13,15-17H,8,11-12H2,2-3H3/t13?,15-,16-/m1/s1 |
| InChIKey | YDVCHAFBTNZXGC-GNHXQJIDSA-N |
| XLogP | 1.97 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|