C15H22O3 — CID 101232048
(2S,4S,5S)-5-hydroxy-4-methyl-2-phenylmethoxyheptan-3-one (PubChem CID 101232048) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2S,4S,5S)-5-hydroxy-4-methyl-2-phenylmethoxyheptan-3-one.
| Compound Name | (2S,4S,5S)-5-hydroxy-4-methyl-2-phenylmethoxyheptan-3-one |
|---|---|
| PubChem CID | 101232048 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2S,4S,5S)-5-hydroxy-4-methyl-2-phenylmethoxyheptan-3-one |
| SMILES | CC[C@H](O)[C@H](C)C(=O)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C15H22O3/c1-4-14(16)11(2)15(17)12(3)18-10-13-8-6-5-7-9-13/h5-9,11-12,14,16H,4,10H2,1-3H3/t11-,12-,14-/m0/s1 |
| InChIKey | JKCMZQXEOVDDOL-OBJOEFQTSA-N |
| XLogP | 2.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |