C17H26O3 — CID 15891028
(2S,3R,4R,6R,7R)-3,7-dihydroxy-4,6-dimethyl-2-phenylnonan-5-one (PubChem CID 15891028) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (2S,3R,4R,6R,7R)-3,7-dihydroxy-4,6-dimethyl-2-phenylnonan-5-one.
| Compound Name | (2S,3R,4R,6R,7R)-3,7-dihydroxy-4,6-dimethyl-2-phenylnonan-5-one |
|---|---|
| PubChem CID | 15891028 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (2S,3R,4R,6R,7R)-3,7-dihydroxy-4,6-dimethyl-2-phenylnonan-5-one |
| SMILES | CC[C@@H](O)[C@@H](C)C(=O)[C@H](C)[C@H](O)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C17H26O3/c1-5-15(18)12(3)17(20)13(4)16(19)11(2)14-9-7-6-8-10-14/h6-13,15-16,18-19H,5H2,1-4H3/t11-,12+,13+,15+,16+/m0/s1 |
| InChIKey | WGEMRRJFKKHXGY-YAYDYNKSSA-N |
| XLogP | 2.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |