C16H25NO2 — CID 101250349
2-deuterio-N,N-diethyl-3-hydroxy-2-methyl-4-phenylpentanamide (PubChem CID 101250349) has the molecular formula C16H25NO2 and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-deuterio-N,N-diethyl-3-hydroxy-2-methyl-4-phenylpentanamide.
| Compound Name | 2-deuterio-N,N-diethyl-3-hydroxy-2-methyl-4-phenylpentanamide |
|---|---|
| PubChem CID | 101250349 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 2-deuterio-N,N-diethyl-3-hydroxy-2-methyl-4-phenylpentanamide |
| SMILES | [2H]C(C)(C(=O)N(CC)CC)C(O)C(C)c1ccccc1 |
| InChI | InChI=1S/C16H25NO2/c1-5-17(6-2)16(19)13(4)15(18)12(3)14-10-8-7-9-11-14/h7-13,15,18H,5-6H2,1-4H3/i13D |
| InChIKey | CSTIRNOOMRHAGW-YSOHJTORSA-N |
| XLogP | 2.66 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |