C22H29NO — CID 102499696
2-(4-tert-butylphenyl)-N,N-diethyl-2-phenylacetamide (PubChem CID 102499696) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N,N-diethyl-2-phenylacetamide.
| Compound Name | 2-(4-tert-butylphenyl)-N,N-diethyl-2-phenylacetamide |
|---|---|
| PubChem CID | 102499696 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N,N-diethyl-2-phenylacetamide |
| SMILES | CCN(CC)C(=O)C(c1ccccc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H29NO/c1-6-23(7-2)21(24)20(17-11-9-8-10-12-17)18-13-15-19(16-14-18)22(3,4)5/h8-16,20H,6-7H2,1-5H3 |
| InChIKey | YOBAEUKWNMUBBK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |