C24H26NO2P — CID 14897370
2-diphenylphosphoryl-N,N-diethyl-2-phenylacetamide (PubChem CID 14897370) has the molecular formula C24H26NO2P and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-diphenylphosphoryl-N,N-diethyl-2-phenylacetamide.
| Compound Name | 2-diphenylphosphoryl-N,N-diethyl-2-phenylacetamide |
|---|---|
| PubChem CID | 14897370 |
| Molecular Formula | C24H26NO2P |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 2-diphenylphosphoryl-N,N-diethyl-2-phenylacetamide |
| SMILES | CCN(CC)C(=O)C(c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26NO2P/c1-3-25(4-2)24(26)23(20-14-8-5-9-15-20)28(27,21-16-10-6-11-17-21)22-18-12-7-13-19-22/h5-19,23H,3-4H2,1-2H3 |
| InChIKey | JQYBBIABSHPOBG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|