C43H49N3O4P2 — CID 139139253
(2S)-3-[6-[(2S)-3-(diethylamino)-2-diphenylphosphoryl-3-oxopropyl]-2-pyridinyl]-2-diphenylphosphoryl-N,N-diethylpropanamide (PubChem CID 139139253) has the molecular formula C43H49N3O4P2 and a molecular weight of 733.83 g/mol. Its IUPAC name is (2S)-3-[6-[(2S)-3-(diethylamino)-2-diphenylphosphoryl-3-oxopropyl]-2-pyridinyl]-2-diphenylphosphoryl-N,N-diethylpropanamide.
| Compound Name | (2S)-3-[6-[(2S)-3-(diethylamino)-2-diphenylphosphoryl-3-oxopropyl]-2-pyridinyl]-2-diphenylphosphoryl-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 139139253 |
| Molecular Formula | C43H49N3O4P2 |
| Molecular Weight | 733.83 g/mol |
| Exact Mass | 733.32 |
| IUPAC Name | (2S)-3-[6-[(2S)-3-(diethylamino)-2-diphenylphosphoryl-3-oxopropyl]-2-pyridinyl]-2-diphenylphosphoryl-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)[C@H](Cc1cccc(C[C@@H](C(=O)N(CC)CC)P(=O)(c2ccccc2)c2ccccc2)n1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H49N3O4P2/c1-5-45(6-2)42(47)40(51(49,36-24-13-9-14-25-36)37-26-15-10-16-27-37)32-34-22-21-23-35(44-34)33-41(43(48)46(7-3)8-4)52(50,38-28-17-11-18-29-38)39-30-19-12-20-31-39/h9-31,40-41H,5-8,32-33H2,1-4H3/t40-,41-/m0/s1 |
| InChIKey | PTIMYKMCFIPUGK-YATWDLPUSA-N |
| XLogP | 6.67 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.83 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|