C19H24NOPS — CID 2828065
2-diphenylphosphinothioyl-N,N-diethylpropanamide (PubChem CID 2828065) has the molecular formula C19H24NOPS and a molecular weight of 345.45 g/mol. Its IUPAC name is 2-diphenylphosphinothioyl-N,N-diethylpropanamide.
| Compound Name | 2-diphenylphosphinothioyl-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 2828065 |
| Molecular Formula | C19H24NOPS |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-diphenylphosphinothioyl-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)P(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24NOPS/c1-4-20(5-2)19(21)16(3)22(23,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-16H,4-5H2,1-3H3 |
| InChIKey | PJIZCRLQODVUBO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|