About oxalic acid;1-phenylpropylbenzene
oxalic acid;1-phenylpropylbenzene (PubChem CID 67824543) has the molecular formula C17H18O4
and a molecular weight of 286.33 g/mol. Its IUPAC name is oxalic acid;1-phenylpropylbenzene.
Molecular Properties
| Compound Name | oxalic acid;1-phenylpropylbenzene |
| PubChem CID | 67824543 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | oxalic acid;1-phenylpropylbenzene |
| SMILES | CCC(c1ccccc1)c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H16.C2H2O4/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;3-1(4)2(5)6/h3-12,15H,2H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | LXVJIYWPHJHBJH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze oxalic acid;1-phenylpropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalic acid;1-phenylpropylbenzene?
The IUPAC name of oxalic acid;1-phenylpropylbenzene (CID 67824543) is oxalic acid;1-phenylpropylbenzene.
What is the SMILES notation for oxalic acid;1-phenylpropylbenzene?
The canonical SMILES for oxalic acid;1-phenylpropylbenzene is CCC(c1ccccc1)c1ccccc1.O=C(O)C(=O)O.
What is the InChIKey of oxalic acid;1-phenylpropylbenzene?
The InChIKey is LXVJIYWPHJHBJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16.C2H2O4/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;3-1(4)2(5)6/h3-12,15H,2H2,1H3;(H,3,4)(H,5,6).
What are the key properties of oxalic acid;1-phenylpropylbenzene?
oxalic acid;1-phenylpropylbenzene has a molecular weight of 286.33 g/mol, XLogP of 3.38, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxalic acid;1-phenylpropylbenzene is sourced from PubChem (CID 67824543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).