About phenylmethanamine;1-phenylpropylbenzene
phenylmethanamine;1-phenylpropylbenzene (PubChem CID 19985231) has the molecular formula C22H25N
and a molecular weight of 303.45 g/mol. Its IUPAC name is phenylmethanamine;1-phenylpropylbenzene.
Molecular Properties
| Compound Name | phenylmethanamine;1-phenylpropylbenzene |
| PubChem CID | 19985231 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | phenylmethanamine;1-phenylpropylbenzene |
| SMILES | CCC(c1ccccc1)c1ccccc1.NCc1ccccc1 |
| InChI | InChI=1S/C15H16.C7H9N/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;8-6-7-4-2-1-3-5-7/h3-12,15H,2H2,1H3;1-5H,6,8H2 |
| InChIKey | PJTIOUCLSSOISS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze phenylmethanamine;1-phenylpropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethanamine;1-phenylpropylbenzene?
The IUPAC name of phenylmethanamine;1-phenylpropylbenzene (CID 19985231) is phenylmethanamine;1-phenylpropylbenzene.
What is the SMILES notation for phenylmethanamine;1-phenylpropylbenzene?
The canonical SMILES for phenylmethanamine;1-phenylpropylbenzene is CCC(c1ccccc1)c1ccccc1.NCc1ccccc1.
What is the InChIKey of phenylmethanamine;1-phenylpropylbenzene?
The InChIKey is PJTIOUCLSSOISS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16.C7H9N/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;8-6-7-4-2-1-3-5-7/h3-12,15H,2H2,1H3;1-5H,6,8H2.
What are the key properties of phenylmethanamine;1-phenylpropylbenzene?
phenylmethanamine;1-phenylpropylbenzene has a molecular weight of 303.45 g/mol, XLogP of 5.37, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethanamine;1-phenylpropylbenzene is sourced from PubChem (CID 19985231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).