(2R)-3-ethyl-2-phenylpentanoic acid

C13H18O2 — CID 124511908

IUPAC(2R)-3-ethyl-2-phenylpentanoic acid
SMILESCCC(CC)[C@@H](C(=O)O)c1ccccc1
InChIInChI=1S/C13H18O2/c1-3-10(4-2)12(13(14)15)11-8-6-5-7-9-11/h5-10,12H,3-4H2,1-2H3,(H,14,15)/t12-/m1/s1
InChIKeyFJOBGMYNAZCGSS-GFCCVEGCSA-N
MW206.29 g/mol
LogP3.29
Rot. Bonds5

About (2R)-3-ethyl-2-phenylpentanoic acid

(2R)-3-ethyl-2-phenylpentanoic acid (PubChem CID 124511908) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is (2R)-3-ethyl-2-phenylpentanoic acid.

Molecular Properties

Compound Name(2R)-3-ethyl-2-phenylpentanoic acid
PubChem CID124511908
Molecular FormulaC13H18O2
Molecular Weight206.29 g/mol
Exact Mass206.13
IUPAC Name(2R)-3-ethyl-2-phenylpentanoic acid
SMILESCCC(CC)[C@@H](C(=O)O)c1ccccc1
InChIInChI=1S/C13H18O2/c1-3-10(4-2)12(13(14)15)11-8-6-5-7-9-11/h5-10,12H,3-4H2,1-2H3,(H,14,15)/t12-/m1/s1
InChIKeyFJOBGMYNAZCGSS-GFCCVEGCSA-N
XLogP3.29
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.29
LogP ≤ 53.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (2R)-3-ethyl-2-phenylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-ethyl-2-phenylhexanoic acid
CID 143465377
(2R)-3-methyl-2-phenylbutanoic acid
CID 7290444
3-[hydroxy(methyl)phosphoryl]-2-phenylpentanoic acid
CID 19357757
4-ethoxy-3-ethoxycarbonyl-4-oxo-2-phenylbutanoic acid
CID 102417452
3-(ethylamino)-2,3-diphenylpropanoic acid
CID 50877823
2-phenyl-3-sulfanylbutanoic acid
CID 22460484
oxalic acid;1-phenylpropylbenzene
CID 67824543
4-methyl-2,3-diphenylpentanoic acid
CID 13280236
3-ethyl-4-phenylpentanoic acid
CID 57075927
2-bromo-3-phenylbutanedioic acid
CID 18967008
3-(3-ethylpentan-2-ylamino)-2-phenylpropanoic acid
CID 64559425
2-[methyl(1-phenylpropyl)amino]butanoic acid
CID 65067637

Frequently Asked Questions

What is the IUPAC name of (2R)-3-ethyl-2-phenylpentanoic acid?
The IUPAC name of (2R)-3-ethyl-2-phenylpentanoic acid (CID 124511908) is (2R)-3-ethyl-2-phenylpentanoic acid.
What is the SMILES notation for (2R)-3-ethyl-2-phenylpentanoic acid?
The canonical SMILES for (2R)-3-ethyl-2-phenylpentanoic acid is CCC(CC)[C@@H](C(=O)O)c1ccccc1.
What is the InChIKey of (2R)-3-ethyl-2-phenylpentanoic acid?
The InChIKey is FJOBGMYNAZCGSS-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H18O2/c1-3-10(4-2)12(13(14)15)11-8-6-5-7-9-11/h5-10,12H,3-4H2,1-2H3,(H,14,15)/t12-/m1/s1.
What are the key properties of (2R)-3-ethyl-2-phenylpentanoic acid?
(2R)-3-ethyl-2-phenylpentanoic acid has a molecular weight of 206.29 g/mol, XLogP of 3.29, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-ethyl-2-phenylpentanoic acid is sourced from PubChem (CID 124511908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).