3-(ethylamino)-2,3-diphenylpropanoic acid

C17H19NO2 — CID 50877823

IUPAC3-(ethylamino)-2,3-diphenylpropanoic acid
SMILESCCNC(c1ccccc1)C(C(=O)O)c1ccccc1
InChIInChI=1S/C17H19NO2/c1-2-18-16(14-11-7-4-8-12-14)15(17(19)20)13-9-5-3-6-10-13/h3-12,15-16,18H,2H2,1H3,(H,19,20)
InChIKeyBFZUIXQQVLSKGV-UHFFFAOYSA-N
MW269.34 g/mol
LogP3.21
Rot. Bonds6

About 3-(ethylamino)-2,3-diphenylpropanoic acid

3-(ethylamino)-2,3-diphenylpropanoic acid (PubChem CID 50877823) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-(ethylamino)-2,3-diphenylpropanoic acid.

Molecular Properties

Compound Name3-(ethylamino)-2,3-diphenylpropanoic acid
PubChem CID50877823
Molecular FormulaC17H19NO2
Molecular Weight269.34 g/mol
Exact Mass269.14
IUPAC Name3-(ethylamino)-2,3-diphenylpropanoic acid
SMILESCCNC(c1ccccc1)C(C(=O)O)c1ccccc1
InChIInChI=1S/C17H19NO2/c1-2-18-16(14-11-7-4-8-12-14)15(17(19)20)13-9-5-3-6-10-13/h3-12,15-16,18H,2H2,1H3,(H,19,20)
InChIKeyBFZUIXQQVLSKGV-UHFFFAOYSA-N
XLogP3.21
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.34
LogP ≤ 53.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(ethylamino)-2,3-diphenylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(ethylamino)-2,3-diphenylpropanoic acid?
The IUPAC name of 3-(ethylamino)-2,3-diphenylpropanoic acid (CID 50877823) is 3-(ethylamino)-2,3-diphenylpropanoic acid.
What is the SMILES notation for 3-(ethylamino)-2,3-diphenylpropanoic acid?
The canonical SMILES for 3-(ethylamino)-2,3-diphenylpropanoic acid is CCNC(c1ccccc1)C(C(=O)O)c1ccccc1.
What is the InChIKey of 3-(ethylamino)-2,3-diphenylpropanoic acid?
The InChIKey is BFZUIXQQVLSKGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-2-18-16(14-11-7-4-8-12-14)15(17(19)20)13-9-5-3-6-10-13/h3-12,15-16,18H,2H2,1H3,(H,19,20).
What are the key properties of 3-(ethylamino)-2,3-diphenylpropanoic acid?
3-(ethylamino)-2,3-diphenylpropanoic acid has a molecular weight of 269.34 g/mol, XLogP of 3.21, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylamino)-2,3-diphenylpropanoic acid is sourced from PubChem (CID 50877823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).