C17H19NO2 — CID 50877823
3-(ethylamino)-2,3-diphenylpropanoic acid (PubChem CID 50877823) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-(ethylamino)-2,3-diphenylpropanoic acid.
| Compound Name | 3-(ethylamino)-2,3-diphenylpropanoic acid |
|---|---|
| PubChem CID | 50877823 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-(ethylamino)-2,3-diphenylpropanoic acid |
| SMILES | CCNC(c1ccccc1)C(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C17H19NO2/c1-2-18-16(14-11-7-4-8-12-14)15(17(19)20)13-9-5-3-6-10-13/h3-12,15-16,18H,2H2,1H3,(H,19,20) |
| InChIKey | BFZUIXQQVLSKGV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |