About (E)-3-phenylprop-2-enamide;1-phenylpropylbenzene
(E)-3-phenylprop-2-enamide;1-phenylpropylbenzene (PubChem CID 142088142) has the molecular formula C24H25NO
and a molecular weight of 343.47 g/mol. Its IUPAC name is (E)-3-phenylprop-2-enamide;1-phenylpropylbenzene.
Molecular Properties
| Compound Name | (E)-3-phenylprop-2-enamide;1-phenylpropylbenzene |
| PubChem CID | 142088142 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (E)-3-phenylprop-2-enamide;1-phenylpropylbenzene |
| SMILES | CCC(c1ccccc1)c1ccccc1.NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H16.C9H9NO/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;10-9(11)7-6-8-4-2-1-3-5-8/h3-12,15H,2H2,1H3;1-7H,(H2,10,11)/b;7-6+ |
| InChIKey | OYHNKQFNGYTONP-UETGHTDLSA-N |
| XLogP | 5.41 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-phenylprop-2-enamide;1-phenylpropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-phenylprop-2-enamide;1-phenylpropylbenzene?
The IUPAC name of (E)-3-phenylprop-2-enamide;1-phenylpropylbenzene (CID 142088142) is (E)-3-phenylprop-2-enamide;1-phenylpropylbenzene.
What is the SMILES notation for (E)-3-phenylprop-2-enamide;1-phenylpropylbenzene?
The canonical SMILES for (E)-3-phenylprop-2-enamide;1-phenylpropylbenzene is CCC(c1ccccc1)c1ccccc1.NC(=O)/C=C/c1ccccc1.
What is the InChIKey of (E)-3-phenylprop-2-enamide;1-phenylpropylbenzene?
The InChIKey is OYHNKQFNGYTONP-UETGHTDLSA-N. The full InChI is InChI=1S/C15H16.C9H9NO/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;10-9(11)7-6-8-4-2-1-3-5-8/h3-12,15H,2H2,1H3;1-7H,(H2,10,11)/b;7-6+.
What are the key properties of (E)-3-phenylprop-2-enamide;1-phenylpropylbenzene?
(E)-3-phenylprop-2-enamide;1-phenylpropylbenzene has a molecular weight of 343.47 g/mol, XLogP of 5.41, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-phenylprop-2-enamide;1-phenylpropylbenzene is sourced from PubChem (CID 142088142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).