C13H15NO — CID 70372296
(2E,6Z)-7-phenylhepta-2,6-dienamide (PubChem CID 70372296) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is (2E,6Z)-7-phenylhepta-2,6-dienamide.
| Compound Name | (2E,6Z)-7-phenylhepta-2,6-dienamide |
|---|---|
| PubChem CID | 70372296 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (2E,6Z)-7-phenylhepta-2,6-dienamide |
| SMILES | NC(=O)/C=C/CC/C=C\c1ccccc1 |
| InChI | InChI=1S/C13H15NO/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3-11H,1-2H2,(H2,14,15)/b8-4-,11-7+ |
| InChIKey | ACZDPWMVBMBGSW-USRDNGHPSA-N |
| XLogP | 2.52 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|