C20H27NO — CID 57005332
1-(3,5-dimethylpiperidin-1-yl)-7-phenylhepta-2,6-dien-1-one (PubChem CID 57005332) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 1-(3,5-dimethylpiperidin-1-yl)-7-phenylhepta-2,6-dien-1-one.
| Compound Name | 1-(3,5-dimethylpiperidin-1-yl)-7-phenylhepta-2,6-dien-1-one |
|---|---|
| PubChem CID | 57005332 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 1-(3,5-dimethylpiperidin-1-yl)-7-phenylhepta-2,6-dien-1-one |
| SMILES | CC1CC(C)CN(C(=O)C=CCCC=Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H27NO/c1-17-14-18(2)16-21(15-17)20(22)13-9-4-3-6-10-19-11-7-5-8-12-19/h5-13,17-18H,3-4,14-16H2,1-2H3 |
| InChIKey | DQPOSBXTZRCXFF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|