C17H21NO — CID 24842724
(2Z,4E)-1-(3-methylpiperidin-1-yl)-5-phenylpenta-2,4-dien-1-one (PubChem CID 24842724) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is (2Z,4E)-1-(3-methylpiperidin-1-yl)-5-phenylpenta-2,4-dien-1-one.
| Compound Name | (2Z,4E)-1-(3-methylpiperidin-1-yl)-5-phenylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 24842724 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (2Z,4E)-1-(3-methylpiperidin-1-yl)-5-phenylpenta-2,4-dien-1-one |
| SMILES | CC1CCCN(C(=O)/C=C\C=C\c2ccccc2)C1 |
| InChI | InChI=1S/C17H21NO/c1-15-8-7-13-18(14-15)17(19)12-6-5-11-16-9-3-2-4-10-16/h2-6,9-12,15H,7-8,13-14H2,1H3/b11-5+,12-6- |
| InChIKey | RALWLZJBPJEGDC-MCSXFCTQSA-N |
| XLogP | 3.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|