C16H19NO — CID 2798165
5-phenyl-1-piperidin-1-ylpenta-2,4-dien-1-one (PubChem CID 2798165) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 5-phenyl-1-piperidin-1-ylpenta-2,4-dien-1-one.
| Compound Name | 5-phenyl-1-piperidin-1-ylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 2798165 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 5-phenyl-1-piperidin-1-ylpenta-2,4-dien-1-one |
| SMILES | O=C(C=CC=Cc1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C16H19NO/c18-16(17-13-7-2-8-14-17)12-6-5-11-15-9-3-1-4-10-15/h1,3-6,9-12H,2,7-8,13-14H2 |
| InChIKey | VNWDZNZLPSUNTD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|