C29H29NO7 — CID 160815421
(2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoic acid;(2E,4E)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one (PubChem CID 160815421) has the molecular formula C29H29NO7 and a molecular weight of 503.55 g/mol. Its IUPAC name is (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoic acid;(2E,4E)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one.
| Compound Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoic acid;(2E,4E)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 160815421 |
| Molecular Formula | C29H29NO7 |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoic acid;(2E,4E)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
| SMILES | O=C(/C=C/C=C/c1ccc2c(c1)OCO2)N1CCCCC1.O=C(O)/C=C/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H19NO3.C12H10O4/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15;13-12(14)4-2-1-3-9-5-6-10-11(7-9)16-8-15-10/h2-3,6-9,12H,1,4-5,10-11,13H2;1-7H,8H2,(H,13,14)/b6-2+,7-3+;3-1+,4-2+ |
| InChIKey | SEVLBTUOKBBIBV-OSCHLSILSA-N |
| XLogP | 5.07 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|