C19H23N3O4 — CID 178072272
4-[(2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoyl]-N-ethylpiperazine-1-carboxamide (PubChem CID 178072272) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-[(2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoyl]-N-ethylpiperazine-1-carboxamide.
| Compound Name | 4-[(2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoyl]-N-ethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 178072272 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-[(2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoyl]-N-ethylpiperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(C(=O)/C=C/C=C/c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C19H23N3O4/c1-2-20-19(24)22-11-9-21(10-12-22)18(23)6-4-3-5-15-7-8-16-17(13-15)26-14-25-16/h3-8,13H,2,9-12,14H2,1H3,(H,20,24)/b5-3+,6-4+ |
| InChIKey | DNFBEHUXKOMODH-GGWOSOGESA-N |
| XLogP | 1.86 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|