C22H24N4O3 — CID 172559067
(2E,4E)-5-(1,3-benzodioxol-5-yl)-1-[4-(5-ethylpyrimidin-2-yl)piperazin-1-yl]penta-2,4-dien-1-one (PubChem CID 172559067) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-[4-(5-ethylpyrimidin-2-yl)piperazin-1-yl]penta-2,4-dien-1-one.
| Compound Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-[4-(5-ethylpyrimidin-2-yl)piperazin-1-yl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 172559067 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-[4-(5-ethylpyrimidin-2-yl)piperazin-1-yl]penta-2,4-dien-1-one |
| SMILES | CCc1cnc(N2CCN(C(=O)/C=C/C=C/c3ccc4c(c3)OCO4)CC2)nc1 |
| InChI | InChI=1S/C22H24N4O3/c1-2-17-14-23-22(24-15-17)26-11-9-25(10-12-26)21(27)6-4-3-5-18-7-8-19-20(13-18)29-16-28-19/h3-8,13-15H,2,9-12,16H2,1H3/b5-3+,6-4+ |
| InChIKey | OXIIQOKBDGGHGS-GGWOSOGESA-N |
| XLogP | 2.69 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|