C22H21FN2O3 — CID 172559068
(2E,4E)-5-(1,3-benzodioxol-5-yl)-1-[4-(4-fluorophenyl)piperazin-1-yl]penta-2,4-dien-1-one (PubChem CID 172559068) has the molecular formula C22H21FN2O3 and a molecular weight of 380.42 g/mol. Its IUPAC name is (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-[4-(4-fluorophenyl)piperazin-1-yl]penta-2,4-dien-1-one.
| Compound Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-[4-(4-fluorophenyl)piperazin-1-yl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 172559068 |
| Molecular Formula | C22H21FN2O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-[4-(4-fluorophenyl)piperazin-1-yl]penta-2,4-dien-1-one |
| SMILES | O=C(/C=C/C=C/c1ccc2c(c1)OCO2)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H21FN2O3/c23-18-6-8-19(9-7-18)24-11-13-25(14-12-24)22(26)4-2-1-3-17-5-10-20-21(15-17)28-16-27-20/h1-10,15H,11-14,16H2/b3-1+,4-2+ |
| InChIKey | WTOJYBKJFMKTJT-ZPUQHVIOSA-N |
| XLogP | 3.47 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|