C23H24FN3O5 — CID 6724109
3-(1,3-benzodioxol-5-yl)-N-[(2S)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-hydroxy-1-oxopropan-2-yl]prop-2-enamide (PubChem CID 6724109) has the molecular formula C23H24FN3O5 and a molecular weight of 441.46 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[(2S)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-hydroxy-1-oxopropan-2-yl]prop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[(2S)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-hydroxy-1-oxopropan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6724109 |
| Molecular Formula | C23H24FN3O5 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[(2S)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-hydroxy-1-oxopropan-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)N[C@@H](CO)C(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H24FN3O5/c24-17-3-5-18(6-4-17)26-9-11-27(12-10-26)23(30)19(14-28)25-22(29)8-2-16-1-7-20-21(13-16)32-15-31-20/h1-8,13,19,28H,9-12,14-15H2,(H,25,29)/t19-/m0/s1 |
| InChIKey | RXULFXWATSNUBL-IBGZPJMESA-N |
| XLogP | 1.39 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|