C21H22N4O7 — CID 5164665
N-[3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 5164665) has the molecular formula C21H22N4O7 and a molecular weight of 442.43 g/mol. Its IUPAC name is N-[3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 5164665 |
| Molecular Formula | C21H22N4O7 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-[3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NC(CO)C(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H22N4O7/c26-12-17(22-20(27)14-1-6-18-19(11-14)32-13-31-18)21(28)24-9-7-23(8-10-24)15-2-4-16(5-3-15)25(29)30/h1-6,11,17,26H,7-10,12-13H2,(H,22,27) |
| InChIKey | DMJRMUYROPUHKV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 134.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|