C26H25F2N5O7 — CID 4231331
6,7-difluoro-N-[3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxamide (PubChem CID 4231331) has the molecular formula C26H25F2N5O7 and a molecular weight of 557.51 g/mol. Its IUPAC name is 6,7-difluoro-N-[3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxamide.
| Compound Name | 6,7-difluoro-N-[3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 4231331 |
| Molecular Formula | C26H25F2N5O7 |
| Molecular Weight | 557.51 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 6,7-difluoro-N-[3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxamide |
| SMILES | CC1COc2c(F)c(F)cc3c(=O)c(C(=O)NC(CO)C(=O)N4CCN(c5ccc([N+](=O)[O-])cc5)CC4)cn1c23 |
| InChI | InChI=1S/C26H25F2N5O7/c1-14-13-40-24-21(28)19(27)10-17-22(24)32(14)11-18(23(17)35)25(36)29-20(12-34)26(37)31-8-6-30(7-9-31)15-2-4-16(5-3-15)33(38)39/h2-5,10-11,14,20,34H,6-9,12-13H2,1H3,(H,29,36) |
| InChIKey | LVCHXKVQZOLJPK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 147.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.51 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|